C19H28N4O6S — CID 88635826
2-[1-[1-[[2-hydroxy-3-[(2-methyl-1H-indol-4-yl)oxy]propyl]amino]ethylamino]-1-oxopropan-2-yl]sulfanylethyl nitrate (PubChem CID 88635826) has the molecular formula C19H28N4O6S and a molecular weight of 440.52 g/mol. Its IUPAC name is 2-[1-[1-[[2-hydroxy-3-[(2-methyl-1H-indol-4-yl)oxy]propyl]amino]ethylamino]-1-oxopropan-2-yl]sulfanylethyl nitrate.
| Compound Name | 2-[1-[1-[[2-hydroxy-3-[(2-methyl-1H-indol-4-yl)oxy]propyl]amino]ethylamino]-1-oxopropan-2-yl]sulfanylethyl nitrate |
|---|---|
| PubChem CID | 88635826 |
| Molecular Formula | C19H28N4O6S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 2-[1-[1-[[2-hydroxy-3-[(2-methyl-1H-indol-4-yl)oxy]propyl]amino]ethylamino]-1-oxopropan-2-yl]sulfanylethyl nitrate |
| SMILES | Cc1cc2c(OCC(O)CNC(C)NC(=O)C(C)SCCO[N+](=O)[O-])cccc2[nH]1 |
| InChI | InChI=1S/C19H28N4O6S/c1-12-9-16-17(21-12)5-4-6-18(16)28-11-15(24)10-20-14(3)22-19(25)13(2)30-8-7-29-23(26)27/h4-6,9,13-15,20-21,24H,7-8,10-11H2,1-3H3,(H,22,25) |
| InChIKey | XFLQNJNAUYOYCO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 138.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|