C20H30N4O7S — CID 19852932
2-[1-[2-[[2-hydroxy-3-[(7-methyl-2-oxo-3,4-dihydro-1H-quinolin-5-yl)oxy]propyl]amino]ethylamino]-1-oxopropan-2-yl]sulfanylethyl nitrate (PubChem CID 19852932) has the molecular formula C20H30N4O7S and a molecular weight of 470.55 g/mol. Its IUPAC name is 2-[1-[2-[[2-hydroxy-3-[(7-methyl-2-oxo-3,4-dihydro-1H-quinolin-5-yl)oxy]propyl]amino]ethylamino]-1-oxopropan-2-yl]sulfanylethyl nitrate.
| Compound Name | 2-[1-[2-[[2-hydroxy-3-[(7-methyl-2-oxo-3,4-dihydro-1H-quinolin-5-yl)oxy]propyl]amino]ethylamino]-1-oxopropan-2-yl]sulfanylethyl nitrate |
|---|---|
| PubChem CID | 19852932 |
| Molecular Formula | C20H30N4O7S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 2-[1-[2-[[2-hydroxy-3-[(7-methyl-2-oxo-3,4-dihydro-1H-quinolin-5-yl)oxy]propyl]amino]ethylamino]-1-oxopropan-2-yl]sulfanylethyl nitrate |
| SMILES | Cc1cc2c(c(OCC(O)CNCCNC(=O)C(C)SCCO[N+](=O)[O-])c1)CCC(=O)N2 |
| InChI | InChI=1S/C20H30N4O7S/c1-13-9-17-16(3-4-19(26)23-17)18(10-13)30-12-15(25)11-21-5-6-22-20(27)14(2)32-8-7-31-24(28)29/h9-10,14-15,21,25H,3-8,11-12H2,1-2H3,(H,22,27)(H,23,26) |
| InChIKey | LLXHSTCWMAPSCB-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 152.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|