C16H24ClN3O7 — CID 19853047
2-[2-[2-[[3-(2-chloro-5-methylphenoxy)-2-hydroxypropyl]amino]ethylamino]-2-oxoethoxy]ethyl nitrate (PubChem CID 19853047) has the molecular formula C16H24ClN3O7 and a molecular weight of 405.84 g/mol. Its IUPAC name is 2-[2-[2-[[3-(2-chloro-5-methylphenoxy)-2-hydroxypropyl]amino]ethylamino]-2-oxoethoxy]ethyl nitrate.
| Compound Name | 2-[2-[2-[[3-(2-chloro-5-methylphenoxy)-2-hydroxypropyl]amino]ethylamino]-2-oxoethoxy]ethyl nitrate |
|---|---|
| PubChem CID | 19853047 |
| Molecular Formula | C16H24ClN3O7 |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 2-[2-[2-[[3-(2-chloro-5-methylphenoxy)-2-hydroxypropyl]amino]ethylamino]-2-oxoethoxy]ethyl nitrate |
| SMILES | Cc1ccc(Cl)c(OCC(O)CNCCNC(=O)COCCO[N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H24ClN3O7/c1-12-2-3-14(17)15(8-12)26-10-13(21)9-18-4-5-19-16(22)11-25-6-7-27-20(23)24/h2-3,8,13,18,21H,4-7,9-11H2,1H3,(H,19,22) |
| InChIKey | MGGPMGRUUBXYMS-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 132.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|