C19H28ClN3O6S — CID 19852930
[2-[acetyl-[2-[[3-(2-chloro-5-methylphenoxy)-2-hydroxypropyl]amino]ethyl]amino]sulfanylcyclopentyl] nitrate (PubChem CID 19852930) has the molecular formula C19H28ClN3O6S and a molecular weight of 461.97 g/mol. Its IUPAC name is [2-[acetyl-[2-[[3-(2-chloro-5-methylphenoxy)-2-hydroxypropyl]amino]ethyl]amino]sulfanylcyclopentyl] nitrate.
| Compound Name | [2-[acetyl-[2-[[3-(2-chloro-5-methylphenoxy)-2-hydroxypropyl]amino]ethyl]amino]sulfanylcyclopentyl] nitrate |
|---|---|
| PubChem CID | 19852930 |
| Molecular Formula | C19H28ClN3O6S |
| Molecular Weight | 461.97 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | [2-[acetyl-[2-[[3-(2-chloro-5-methylphenoxy)-2-hydroxypropyl]amino]ethyl]amino]sulfanylcyclopentyl] nitrate |
| SMILES | CC(=O)N(CCNCC(O)COc1cc(C)ccc1Cl)SC1CCCC1O[N+](=O)[O-] |
| InChI | InChI=1S/C19H28ClN3O6S/c1-13-6-7-16(20)18(10-13)28-12-15(25)11-21-8-9-22(14(2)24)30-19-5-3-4-17(19)29-23(26)27/h6-7,10,15,17,19,21,25H,3-5,8-9,11-12H2,1-2H3 |
| InChIKey | ZQYRZNUBVVAOPL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 114.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.97 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|