C19H28N2O4S — CID 23335562
ethyl 4-[2-hydroxy-3-(2-methylsulfanylbutan-2-ylamino)propoxy]-1H-indole-2-carboxylate (PubChem CID 23335562) has the molecular formula C19H28N2O4S and a molecular weight of 380.51 g/mol. Its IUPAC name is ethyl 4-[2-hydroxy-3-(2-methylsulfanylbutan-2-ylamino)propoxy]-1H-indole-2-carboxylate.
| Compound Name | ethyl 4-[2-hydroxy-3-(2-methylsulfanylbutan-2-ylamino)propoxy]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 23335562 |
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | ethyl 4-[2-hydroxy-3-(2-methylsulfanylbutan-2-ylamino)propoxy]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c(OCC(O)CNC(C)(CC)SC)cccc2[nH]1 |
| InChI | InChI=1S/C19H28N2O4S/c1-5-19(3,26-4)20-11-13(22)12-25-17-9-7-8-15-14(17)10-16(21-15)18(23)24-6-2/h7-10,13,20-22H,5-6,11-12H2,1-4H3 |
| InChIKey | OTXQDIWKYITUIC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|