C25H32N2O4 — CID 54125504
ethyl 4-[2-hydroxy-3-(4-phenylbutan-2-ylamino)propoxy]-6-methyl-1H-indole-2-carboxylate (PubChem CID 54125504) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is ethyl 4-[2-hydroxy-3-(4-phenylbutan-2-ylamino)propoxy]-6-methyl-1H-indole-2-carboxylate.
| Compound Name | ethyl 4-[2-hydroxy-3-(4-phenylbutan-2-ylamino)propoxy]-6-methyl-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 54125504 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | ethyl 4-[2-hydroxy-3-(4-phenylbutan-2-ylamino)propoxy]-6-methyl-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c(OCC(O)CNC(C)CCc3ccccc3)cc(C)cc2[nH]1 |
| InChI | InChI=1S/C25H32N2O4/c1-4-30-25(29)23-14-21-22(27-23)12-17(2)13-24(21)31-16-20(28)15-26-18(3)10-11-19-8-6-5-7-9-19/h5-9,12-14,18,20,26-28H,4,10-11,15-16H2,1-3H3 |
| InChIKey | NQRJTSDRIDLUGB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |