C23H27FN2O2 — CID 70594439
(Z)-3-[3-fluoro-4-[2-hydroxy-3-(4-phenylbutan-2-ylamino)propoxy]phenyl]but-2-enenitrile (PubChem CID 70594439) has the molecular formula C23H27FN2O2 and a molecular weight of 382.48 g/mol. Its IUPAC name is (Z)-3-[3-fluoro-4-[2-hydroxy-3-(4-phenylbutan-2-ylamino)propoxy]phenyl]but-2-enenitrile.
| Compound Name | (Z)-3-[3-fluoro-4-[2-hydroxy-3-(4-phenylbutan-2-ylamino)propoxy]phenyl]but-2-enenitrile |
|---|---|
| PubChem CID | 70594439 |
| Molecular Formula | C23H27FN2O2 |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | (Z)-3-[3-fluoro-4-[2-hydroxy-3-(4-phenylbutan-2-ylamino)propoxy]phenyl]but-2-enenitrile |
| SMILES | C/C(=C/C#N)c1ccc(OCC(O)CNC(C)CCc2ccccc2)c(F)c1 |
| InChI | InChI=1S/C23H27FN2O2/c1-17(12-13-25)20-10-11-23(22(24)14-20)28-16-21(27)15-26-18(2)8-9-19-6-4-3-5-7-19/h3-7,10-12,14,18,21,26-27H,8-9,15-16H2,1-2H3/b17-12- |
| InChIKey | DKLLQKCWSONLTJ-ATVHPVEESA-N |
| XLogP | 4.10 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|