C13H17ClN2O3 — CID 21434094
5-chloro-2-[2-hydroxy-3-(1-hydroxypropan-2-ylamino)propoxy]benzonitrile (PubChem CID 21434094) has the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. Its IUPAC name is 5-chloro-2-[2-hydroxy-3-(1-hydroxypropan-2-ylamino)propoxy]benzonitrile.
| Compound Name | 5-chloro-2-[2-hydroxy-3-(1-hydroxypropan-2-ylamino)propoxy]benzonitrile |
|---|---|
| PubChem CID | 21434094 |
| Molecular Formula | C13H17ClN2O3 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 5-chloro-2-[2-hydroxy-3-(1-hydroxypropan-2-ylamino)propoxy]benzonitrile |
| SMILES | CC(CO)NCC(O)COc1ccc(Cl)cc1C#N |
| InChI | InChI=1S/C13H17ClN2O3/c1-9(7-17)16-6-12(18)8-19-13-3-2-11(14)4-10(13)5-15/h2-4,9,12,16-18H,6-8H2,1H3 |
| InChIKey | SXCIMJDWKXPJJU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |