C15H22ClNO3 — CID 12641176
1-[4-chloro-2-[(E)-3-hydroxyprop-1-enyl]phenoxy]-3-(propan-2-ylamino)propan-2-ol (PubChem CID 12641176) has the molecular formula C15H22ClNO3 and a molecular weight of 299.80 g/mol. Its IUPAC name is 1-[4-chloro-2-[(E)-3-hydroxyprop-1-enyl]phenoxy]-3-(propan-2-ylamino)propan-2-ol.
| Compound Name | 1-[4-chloro-2-[(E)-3-hydroxyprop-1-enyl]phenoxy]-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 12641176 |
| Molecular Formula | C15H22ClNO3 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 1-[4-chloro-2-[(E)-3-hydroxyprop-1-enyl]phenoxy]-3-(propan-2-ylamino)propan-2-ol |
| SMILES | CC(C)NCC(O)COc1ccc(Cl)cc1/C=C/CO |
| InChI | InChI=1S/C15H22ClNO3/c1-11(2)17-9-14(19)10-20-15-6-5-13(16)8-12(15)4-3-7-18/h3-6,8,11,14,17-19H,7,9-10H2,1-2H3/b4-3+ |
| InChIKey | CNIQQVZICULXPB-ONEGZZNKSA-N |
| XLogP | 2.08 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |