C24H34N2O3 — CID 67905497
N-butyl-4-[(3R)-3-[(2-hydroxy-3-phenoxypropyl)amino]butyl]benzamide (PubChem CID 67905497) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is N-butyl-4-[(3R)-3-[(2-hydroxy-3-phenoxypropyl)amino]butyl]benzamide.
| Compound Name | N-butyl-4-[(3R)-3-[(2-hydroxy-3-phenoxypropyl)amino]butyl]benzamide |
|---|---|
| PubChem CID | 67905497 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | N-butyl-4-[(3R)-3-[(2-hydroxy-3-phenoxypropyl)amino]butyl]benzamide |
| SMILES | CCCCNC(=O)c1ccc(CC[C@@H](C)NCC(O)COc2ccccc2)cc1 |
| InChI | InChI=1S/C24H34N2O3/c1-3-4-16-25-24(28)21-14-12-20(13-15-21)11-10-19(2)26-17-22(27)18-29-23-8-6-5-7-9-23/h5-9,12-15,19,22,26-27H,3-4,10-11,16-18H2,1-2H3,(H,25,28)/t19-,22?/m1/s1 |
| InChIKey | UZMMXXWJWVSABK-LCQOSCCDSA-N |
| XLogP | 3.57 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|