C19H25NO3S — CID 88707223
2-[5-[(3S)-3-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]butyl]thiophen-2-yl]acetaldehyde (PubChem CID 88707223) has the molecular formula C19H25NO3S and a molecular weight of 347.48 g/mol. Its IUPAC name is 2-[5-[(3S)-3-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]butyl]thiophen-2-yl]acetaldehyde.
| Compound Name | 2-[5-[(3S)-3-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]butyl]thiophen-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 88707223 |
| Molecular Formula | C19H25NO3S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 2-[5-[(3S)-3-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]butyl]thiophen-2-yl]acetaldehyde |
| SMILES | C[C@@H](CCc1ccc(CC=O)s1)NC[C@H](O)COc1ccccc1 |
| InChI | InChI=1S/C19H25NO3S/c1-15(7-8-18-9-10-19(24-18)11-12-21)20-13-16(22)14-23-17-5-3-2-4-6-17/h2-6,9-10,12,15-16,20,22H,7-8,11,13-14H2,1H3/t15-,16-/m0/s1 |
| InChIKey | LZWZFXPMJPAACP-HOTGVXAUSA-N |
| XLogP | 2.84 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|