C20H27ClN2O4 — CID 70496169
4-[(3R)-3-[[2-hydroxy-3-(3-hydroxyphenoxy)propyl]amino]butyl]benzamide;hydrochloride (PubChem CID 70496169) has the molecular formula C20H27ClN2O4 and a molecular weight of 394.90 g/mol. Its IUPAC name is 4-[(3R)-3-[[2-hydroxy-3-(3-hydroxyphenoxy)propyl]amino]butyl]benzamide;hydrochloride.
| Compound Name | 4-[(3R)-3-[[2-hydroxy-3-(3-hydroxyphenoxy)propyl]amino]butyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 70496169 |
| Molecular Formula | C20H27ClN2O4 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 4-[(3R)-3-[[2-hydroxy-3-(3-hydroxyphenoxy)propyl]amino]butyl]benzamide;hydrochloride |
| SMILES | C[C@H](CCc1ccc(C(N)=O)cc1)NCC(O)COc1cccc(O)c1.Cl |
| InChI | InChI=1S/C20H26N2O4.ClH/c1-14(5-6-15-7-9-16(10-8-15)20(21)25)22-12-18(24)13-26-19-4-2-3-17(23)11-19;/h2-4,7-11,14,18,22-24H,5-6,12-13H2,1H3,(H2,21,25);1H/t14-,18?;/m1./s1 |
| InChIKey | AWXKXPBNPYIHIA-BSOSYTQUSA-N |
| XLogP | 2.26 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |