C20H25NO6 — CID 67677935
propyl 2-[[2-hydroxy-3-(3-hydroxyphenoxy)propyl]amino]-2-phenoxyacetate (PubChem CID 67677935) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is propyl 2-[[2-hydroxy-3-(3-hydroxyphenoxy)propyl]amino]-2-phenoxyacetate.
| Compound Name | propyl 2-[[2-hydroxy-3-(3-hydroxyphenoxy)propyl]amino]-2-phenoxyacetate |
|---|---|
| PubChem CID | 67677935 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | propyl 2-[[2-hydroxy-3-(3-hydroxyphenoxy)propyl]amino]-2-phenoxyacetate |
| SMILES | CCCOC(=O)C(NCC(O)COc1cccc(O)c1)Oc1ccccc1 |
| InChI | InChI=1S/C20H25NO6/c1-2-11-25-20(24)19(27-17-8-4-3-5-9-17)21-13-16(23)14-26-18-10-6-7-15(22)12-18/h3-10,12,16,19,21-23H,2,11,13-14H2,1H3 |
| InChIKey | FEXXPEZAHGUCAH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|