C23H33NO3S — CID 54396394
1-[2-methoxy-4-(2-methylsulfanylethyl)phenoxy]-3-(4-phenylbutan-2-ylamino)propan-2-ol (PubChem CID 54396394) has the molecular formula C23H33NO3S and a molecular weight of 403.59 g/mol. Its IUPAC name is 1-[2-methoxy-4-(2-methylsulfanylethyl)phenoxy]-3-(4-phenylbutan-2-ylamino)propan-2-ol.
| Compound Name | 1-[2-methoxy-4-(2-methylsulfanylethyl)phenoxy]-3-(4-phenylbutan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 54396394 |
| Molecular Formula | C23H33NO3S |
| Molecular Weight | 403.59 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | 1-[2-methoxy-4-(2-methylsulfanylethyl)phenoxy]-3-(4-phenylbutan-2-ylamino)propan-2-ol |
| SMILES | COc1cc(CCSC)ccc1OCC(O)CNC(C)CCc1ccccc1 |
| InChI | InChI=1S/C23H33NO3S/c1-18(9-10-19-7-5-4-6-8-19)24-16-21(25)17-27-22-12-11-20(13-14-28-3)15-23(22)26-2/h4-8,11-12,15,18,21,24-25H,9-10,13-14,16-17H2,1-3H3 |
| InChIKey | VKGRBOTYKBAMGB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.59 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |