C17H24N2O4S — CID 23335494
4-[2-hydroxy-3-(2-methylsulfanylbutan-2-ylamino)propoxy]-1H-indole-2-carboxylic acid (PubChem CID 23335494) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is 4-[2-hydroxy-3-(2-methylsulfanylbutan-2-ylamino)propoxy]-1H-indole-2-carboxylic acid.
| Compound Name | 4-[2-hydroxy-3-(2-methylsulfanylbutan-2-ylamino)propoxy]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 23335494 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 4-[2-hydroxy-3-(2-methylsulfanylbutan-2-ylamino)propoxy]-1H-indole-2-carboxylic acid |
| SMILES | CCC(C)(NCC(O)COc1cccc2[nH]c(C(=O)O)cc12)SC |
| InChI | InChI=1S/C17H24N2O4S/c1-4-17(2,24-3)18-9-11(20)10-23-15-7-5-6-13-12(15)8-14(19-13)16(21)22/h5-8,11,18-20H,4,9-10H2,1-3H3,(H,21,22) |
| InChIKey | ZWPAMWHAMSOWBB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|