C19H24ClNO4 — CID 70405843
1-chloroethyl 2-[(2-hydroxy-3-naphthalen-1-yloxypropyl)amino]-2-methylpropanoate (PubChem CID 70405843) has the molecular formula C19H24ClNO4 and a molecular weight of 365.86 g/mol. Its IUPAC name is 1-chloroethyl 2-[(2-hydroxy-3-naphthalen-1-yloxypropyl)amino]-2-methylpropanoate.
| Compound Name | 1-chloroethyl 2-[(2-hydroxy-3-naphthalen-1-yloxypropyl)amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 70405843 |
| Molecular Formula | C19H24ClNO4 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 1-chloroethyl 2-[(2-hydroxy-3-naphthalen-1-yloxypropyl)amino]-2-methylpropanoate |
| SMILES | CC(Cl)OC(=O)C(C)(C)NCC(O)COc1cccc2ccccc12 |
| InChI | InChI=1S/C19H24ClNO4/c1-13(20)25-18(23)19(2,3)21-11-15(22)12-24-17-10-6-8-14-7-4-5-9-16(14)17/h4-10,13,15,21-22H,11-12H2,1-3H3 |
| InChIKey | QWQCVYVKXUASBG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|