C16H21NO5S — CID 138014570
methyl 4-(3-propan-2-ylsulfonylpropoxy)-1H-indole-2-carboxylate (PubChem CID 138014570) has the molecular formula C16H21NO5S and a molecular weight of 339.41 g/mol. Its IUPAC name is methyl 4-(3-propan-2-ylsulfonylpropoxy)-1H-indole-2-carboxylate.
| Compound Name | methyl 4-(3-propan-2-ylsulfonylpropoxy)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 138014570 |
| Molecular Formula | C16H21NO5S |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | methyl 4-(3-propan-2-ylsulfonylpropoxy)-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1cc2c(OCCCS(=O)(=O)C(C)C)cccc2[nH]1 |
| InChI | InChI=1S/C16H21NO5S/c1-11(2)23(19,20)9-5-8-22-15-7-4-6-13-12(15)10-14(17-13)16(18)21-3/h4,6-7,10-11,17H,5,8-9H2,1-3H3 |
| InChIKey | GMNRXZXQCHQHSP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|