C37H45N3O9 — CID 70471167
3-O-ethyl 5-O-[4-[5-[2-hydroxy-3-(propan-2-ylamino)propoxy]naphthalen-1-yl]oxybutyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70471167) has the molecular formula C37H45N3O9 and a molecular weight of 675.78 g/mol. Its IUPAC name is 3-O-ethyl 5-O-[4-[5-[2-hydroxy-3-(propan-2-ylamino)propoxy]naphthalen-1-yl]oxybutyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-ethyl 5-O-[4-[5-[2-hydroxy-3-(propan-2-ylamino)propoxy]naphthalen-1-yl]oxybutyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70471167 |
| Molecular Formula | C37H45N3O9 |
| Molecular Weight | 675.78 g/mol |
| Exact Mass | 675.32 |
| IUPAC Name | 3-O-ethyl 5-O-[4-[5-[2-hydroxy-3-(propan-2-ylamino)propoxy]naphthalen-1-yl]oxybutyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCCCCOc2cccc3c(OCC(O)CNC(C)C)cccc23)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C37H45N3O9/c1-6-46-36(42)33-24(4)39-25(5)34(35(33)26-12-9-13-27(20-26)40(44)45)37(43)48-19-8-7-18-47-31-16-10-15-30-29(31)14-11-17-32(30)49-22-28(41)21-38-23(2)3/h9-17,20,23,28,35,38-39,41H,6-8,18-19,21-22H2,1-5H3 |
| InChIKey | STCWIOFYMQVGAC-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 158.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.78 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|