C21H24N4O12 — CID 10098310
5-O-[(2R)-2-nitrooxypropyl] 3-O-(3-nitrooxypropyl) (4R)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 10098310) has the molecular formula C21H24N4O12 and a molecular weight of 524.44 g/mol. Its IUPAC name is 5-O-[(2R)-2-nitrooxypropyl] 3-O-(3-nitrooxypropyl) (4R)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[(2R)-2-nitrooxypropyl] 3-O-(3-nitrooxypropyl) (4R)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10098310 |
| Molecular Formula | C21H24N4O12 |
| Molecular Weight | 524.44 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | 5-O-[(2R)-2-nitrooxypropyl] 3-O-(3-nitrooxypropyl) (4R)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OCCCO[N+](=O)[O-])[C@@H](c2cccc([N+](=O)[O-])c2)C(C(=O)OC[C@@H](C)O[N+](=O)[O-])=C(C)N1 |
| InChI | InChI=1S/C21H24N4O12/c1-12(37-25(32)33)11-35-21(27)18-14(3)22-13(2)17(20(26)34-8-5-9-36-24(30)31)19(18)15-6-4-7-16(10-15)23(28)29/h4,6-7,10,12,19,22H,5,8-9,11H2,1-3H3/t12-,19-/m1/s1 |
| InChIKey | QSTCLWROWBZZLA-CWTRNNRKSA-N |
| XLogP | 2.11 |
| TPSA | 212.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.44 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|