C21H32N4O7 — CID 88621560
[4-[[2-[[3-[(2-formyl-3,4-dihydro-1H-isoquinolin-5-yl)oxy]-2-hydroxypropyl]amino]-2-methylpropyl]amino]-4-oxobutyl] nitrate (PubChem CID 88621560) has the molecular formula C21H32N4O7 and a molecular weight of 452.51 g/mol. Its IUPAC name is [4-[[2-[[3-[(2-formyl-3,4-dihydro-1H-isoquinolin-5-yl)oxy]-2-hydroxypropyl]amino]-2-methylpropyl]amino]-4-oxobutyl] nitrate.
| Compound Name | [4-[[2-[[3-[(2-formyl-3,4-dihydro-1H-isoquinolin-5-yl)oxy]-2-hydroxypropyl]amino]-2-methylpropyl]amino]-4-oxobutyl] nitrate |
|---|---|
| PubChem CID | 88621560 |
| Molecular Formula | C21H32N4O7 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | [4-[[2-[[3-[(2-formyl-3,4-dihydro-1H-isoquinolin-5-yl)oxy]-2-hydroxypropyl]amino]-2-methylpropyl]amino]-4-oxobutyl] nitrate |
| SMILES | CC(C)(CNC(=O)CCCO[N+](=O)[O-])NCC(O)COc1cccc2c1CCN(C=O)C2 |
| InChI | InChI=1S/C21H32N4O7/c1-21(2,14-22-20(28)7-4-10-32-25(29)30)23-11-17(27)13-31-19-6-3-5-16-12-24(15-26)9-8-18(16)19/h3,5-6,15,17,23,27H,4,7-14H2,1-2H3,(H,22,28) |
| InChIKey | DMAZSBSXCPARQY-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 143.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|