C20H33N5O6 — CID 70380503
[3-[[2-[[2-hydroxy-3-[(3-methyl-1,2-dihydrobenzimidazol-4-yl)oxy]propyl]amino]-2-methylpropyl]amino]-2,2-dimethyl-3-oxopropyl] nitrate (PubChem CID 70380503) has the molecular formula C20H33N5O6 and a molecular weight of 439.51 g/mol. Its IUPAC name is [3-[[2-[[2-hydroxy-3-[(3-methyl-1,2-dihydrobenzimidazol-4-yl)oxy]propyl]amino]-2-methylpropyl]amino]-2,2-dimethyl-3-oxopropyl] nitrate.
| Compound Name | [3-[[2-[[2-hydroxy-3-[(3-methyl-1,2-dihydrobenzimidazol-4-yl)oxy]propyl]amino]-2-methylpropyl]amino]-2,2-dimethyl-3-oxopropyl] nitrate |
|---|---|
| PubChem CID | 70380503 |
| Molecular Formula | C20H33N5O6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | [3-[[2-[[2-hydroxy-3-[(3-methyl-1,2-dihydrobenzimidazol-4-yl)oxy]propyl]amino]-2-methylpropyl]amino]-2,2-dimethyl-3-oxopropyl] nitrate |
| SMILES | CN1CNc2cccc(OCC(O)CNC(C)(C)CNC(=O)C(C)(C)CO[N+](=O)[O-])c21 |
| InChI | InChI=1S/C20H33N5O6/c1-19(2,12-31-25(28)29)18(27)21-11-20(3,4)23-9-14(26)10-30-16-8-6-7-15-17(16)24(5)13-22-15/h6-8,14,22-23,26H,9-13H2,1-5H3,(H,21,27) |
| InChIKey | LFFUXSNEELECSG-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 138.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|