C24H38N4O8 — CID 70380767
[3-[[2-[[3-[2-acetyl-4-(butanoylamino)phenoxy]-2-hydroxypropyl]amino]-2-methylpropyl]amino]-2,2-dimethyl-3-oxopropyl] nitrate (PubChem CID 70380767) has the molecular formula C24H38N4O8 and a molecular weight of 510.59 g/mol. Its IUPAC name is [3-[[2-[[3-[2-acetyl-4-(butanoylamino)phenoxy]-2-hydroxypropyl]amino]-2-methylpropyl]amino]-2,2-dimethyl-3-oxopropyl] nitrate.
| Compound Name | [3-[[2-[[3-[2-acetyl-4-(butanoylamino)phenoxy]-2-hydroxypropyl]amino]-2-methylpropyl]amino]-2,2-dimethyl-3-oxopropyl] nitrate |
|---|---|
| PubChem CID | 70380767 |
| Molecular Formula | C24H38N4O8 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | [3-[[2-[[3-[2-acetyl-4-(butanoylamino)phenoxy]-2-hydroxypropyl]amino]-2-methylpropyl]amino]-2,2-dimethyl-3-oxopropyl] nitrate |
| SMILES | CCCC(=O)Nc1ccc(OCC(O)CNC(C)(C)CNC(=O)C(C)(C)CO[N+](=O)[O-])c(C(C)=O)c1 |
| InChI | InChI=1S/C24H38N4O8/c1-7-8-21(31)27-17-9-10-20(19(11-17)16(2)29)35-13-18(30)12-26-24(5,6)14-25-22(32)23(3,4)15-36-28(33)34/h9-11,18,26,30H,7-8,12-15H2,1-6H3,(H,25,32)(H,27,31) |
| InChIKey | KCLIPJPMVWTGRT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 169.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|