C23H33N3O9 — CID 143057595
[1-[2-acetyl-4-(butanoylamino)phenoxy]-3-[4-nitrooxybutanoyl(propan-2-yl)amino]propan-2-yl] formate (PubChem CID 143057595) has the molecular formula C23H33N3O9 and a molecular weight of 495.53 g/mol. Its IUPAC name is [1-[2-acetyl-4-(butanoylamino)phenoxy]-3-[4-nitrooxybutanoyl(propan-2-yl)amino]propan-2-yl] formate.
| Compound Name | [1-[2-acetyl-4-(butanoylamino)phenoxy]-3-[4-nitrooxybutanoyl(propan-2-yl)amino]propan-2-yl] formate |
|---|---|
| PubChem CID | 143057595 |
| Molecular Formula | C23H33N3O9 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | [1-[2-acetyl-4-(butanoylamino)phenoxy]-3-[4-nitrooxybutanoyl(propan-2-yl)amino]propan-2-yl] formate |
| SMILES | CCCC(=O)Nc1ccc(OCC(CN(C(=O)CCCO[N+](=O)[O-])C(C)C)OC=O)c(C(C)=O)c1 |
| InChI | InChI=1S/C23H33N3O9/c1-5-7-22(29)24-18-9-10-21(20(12-18)17(4)28)33-14-19(34-15-27)13-25(16(2)3)23(30)8-6-11-35-26(31)32/h9-10,12,15-16,19H,5-8,11,13-14H2,1-4H3,(H,24,29) |
| InChIKey | OYRPRTCJFXQUFH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|