C16H27ClN2O4 — CID 45259676
2-[2-[2-hydroxy-3-(propan-2-ylamino)butoxy]phenoxy]-N-methylacetamide;hydrochloride (PubChem CID 45259676) has the molecular formula C16H27ClN2O4 and a molecular weight of 346.86 g/mol. Its IUPAC name is 2-[2-[2-hydroxy-3-(propan-2-ylamino)butoxy]phenoxy]-N-methylacetamide;hydrochloride.
| Compound Name | 2-[2-[2-hydroxy-3-(propan-2-ylamino)butoxy]phenoxy]-N-methylacetamide;hydrochloride |
|---|---|
| PubChem CID | 45259676 |
| Molecular Formula | C16H27ClN2O4 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 2-[2-[2-hydroxy-3-(propan-2-ylamino)butoxy]phenoxy]-N-methylacetamide;hydrochloride |
| SMILES | CNC(=O)COc1ccccc1OCC(O)C(C)NC(C)C.Cl |
| InChI | InChI=1S/C16H26N2O4.ClH/c1-11(2)18-12(3)13(19)9-21-14-7-5-6-8-15(14)22-10-16(20)17-4;/h5-8,11-13,18-19H,9-10H2,1-4H3,(H,17,20);1H |
| InChIKey | FHXWAOQFVXTLER-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |