C17H30N2O7 — CID 70043339
methanamine;1-(2-methoxyphenoxy)-3-(propan-2-ylamino)butan-2-ol;oxalic acid (PubChem CID 70043339) has the molecular formula C17H30N2O7 and a molecular weight of 374.43 g/mol. Its IUPAC name is methanamine;1-(2-methoxyphenoxy)-3-(propan-2-ylamino)butan-2-ol;oxalic acid.
| Compound Name | methanamine;1-(2-methoxyphenoxy)-3-(propan-2-ylamino)butan-2-ol;oxalic acid |
|---|---|
| PubChem CID | 70043339 |
| Molecular Formula | C17H30N2O7 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | methanamine;1-(2-methoxyphenoxy)-3-(propan-2-ylamino)butan-2-ol;oxalic acid |
| SMILES | CN.COc1ccccc1OCC(O)C(C)NC(C)C.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H23NO3.C2H2O4.CH5N/c1-10(2)15-11(3)12(16)9-18-14-8-6-5-7-13(14)17-4;3-1(4)2(5)6;1-2/h5-8,10-12,15-16H,9H2,1-4H3;(H,3,4)(H,5,6);2H2,1H3 |
| InChIKey | NLTVLXRBCBSOFP-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 151.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|