C11H15NO6 — CID 165430264
[(2S)-1,2-dihydroxy-3-(2-methoxyphenoxy)propyl]carbamic acid (PubChem CID 165430264) has the molecular formula C11H15NO6 and a molecular weight of 257.24 g/mol. Its IUPAC name is [(2S)-1,2-dihydroxy-3-(2-methoxyphenoxy)propyl]carbamic acid.
| Compound Name | [(2S)-1,2-dihydroxy-3-(2-methoxyphenoxy)propyl]carbamic acid |
|---|---|
| PubChem CID | 165430264 |
| Molecular Formula | C11H15NO6 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | [(2S)-1,2-dihydroxy-3-(2-methoxyphenoxy)propyl]carbamic acid |
| SMILES | COc1ccccc1OC[C@H](O)C(O)NC(=O)O |
| InChI | InChI=1S/C11H15NO6/c1-17-8-4-2-3-5-9(8)18-6-7(13)10(14)12-11(15)16/h2-5,7,10,12-14H,6H2,1H3,(H,15,16)/t7-,10?/m0/s1 |
| InChIKey | RZBRKXAYUNUGIY-BYDSUWOYSA-N |
| XLogP | 0.02 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|