[(2S)-1,2-dihydroxy-3-(2-methoxyphenoxy)propyl]carbamic acid

C11H15NO6 — CID 165430264

IUPAC[(2S)-1,2-dihydroxy-3-(2-methoxyphenoxy)propyl]carbamic acid
SMILESCOc1ccccc1OC[C@H](O)C(O)NC(=O)O
InChIInChI=1S/C11H15NO6/c1-17-8-4-2-3-5-9(8)18-6-7(13)10(14)12-11(15)16/h2-5,7,10,12-14H,6H2,1H3,(H,15,16)/t7-,10?/m0/s1
InChIKeyRZBRKXAYUNUGIY-BYDSUWOYSA-N
MW257.24 g/mol
LogP0.02
Rot. Bonds6

About [(2S)-1,2-dihydroxy-3-(2-methoxyphenoxy)propyl]carbamic acid

[(2S)-1,2-dihydroxy-3-(2-methoxyphenoxy)propyl]carbamic acid (PubChem CID 165430264) has the molecular formula C11H15NO6 and a molecular weight of 257.24 g/mol. Its IUPAC name is [(2S)-1,2-dihydroxy-3-(2-methoxyphenoxy)propyl]carbamic acid.

Molecular Properties

Compound Name[(2S)-1,2-dihydroxy-3-(2-methoxyphenoxy)propyl]carbamic acid
PubChem CID165430264
Molecular FormulaC11H15NO6
Molecular Weight257.24 g/mol
Exact Mass257.09
IUPAC Name[(2S)-1,2-dihydroxy-3-(2-methoxyphenoxy)propyl]carbamic acid
SMILESCOc1ccccc1OC[C@H](O)C(O)NC(=O)O
InChIInChI=1S/C11H15NO6/c1-17-8-4-2-3-5-9(8)18-6-7(13)10(14)12-11(15)16/h2-5,7,10,12-14H,6H2,1H3,(H,15,16)/t7-,10?/m0/s1
InChIKeyRZBRKXAYUNUGIY-BYDSUWOYSA-N
XLogP0.02
TPSA108.25 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.24
LogP ≤ 50.02
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze [(2S)-1,2-dihydroxy-3-(2-methoxyphenoxy)propyl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(2S)-1,2-dihydroxy-3-(2-methoxyphenoxy)propyl]carbamic acid?
The IUPAC name of [(2S)-1,2-dihydroxy-3-(2-methoxyphenoxy)propyl]carbamic acid (CID 165430264) is [(2S)-1,2-dihydroxy-3-(2-methoxyphenoxy)propyl]carbamic acid.
What is the SMILES notation for [(2S)-1,2-dihydroxy-3-(2-methoxyphenoxy)propyl]carbamic acid?
The canonical SMILES for [(2S)-1,2-dihydroxy-3-(2-methoxyphenoxy)propyl]carbamic acid is COc1ccccc1OC[C@H](O)C(O)NC(=O)O.
What is the InChIKey of [(2S)-1,2-dihydroxy-3-(2-methoxyphenoxy)propyl]carbamic acid?
The InChIKey is RZBRKXAYUNUGIY-BYDSUWOYSA-N. The full InChI is InChI=1S/C11H15NO6/c1-17-8-4-2-3-5-9(8)18-6-7(13)10(14)12-11(15)16/h2-5,7,10,12-14H,6H2,1H3,(H,15,16)/t7-,10?/m0/s1.
What are the key properties of [(2S)-1,2-dihydroxy-3-(2-methoxyphenoxy)propyl]carbamic acid?
[(2S)-1,2-dihydroxy-3-(2-methoxyphenoxy)propyl]carbamic acid has a molecular weight of 257.24 g/mol, XLogP of 0.02, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1,2-dihydroxy-3-(2-methoxyphenoxy)propyl]carbamic acid is sourced from PubChem (CID 165430264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).