C11H14NO6- — CID 19108663
N-[1,2-dihydroxy-3-(2-methoxyphenoxy)propyl]carbamate (PubChem CID 19108663) has the molecular formula C11H14NO6- and a molecular weight of 256.23 g/mol. Its IUPAC name is N-[1,2-dihydroxy-3-(2-methoxyphenoxy)propyl]carbamate.
| Compound Name | N-[1,2-dihydroxy-3-(2-methoxyphenoxy)propyl]carbamate |
|---|---|
| PubChem CID | 19108663 |
| Molecular Formula | C11H14NO6- |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | N-[1,2-dihydroxy-3-(2-methoxyphenoxy)propyl]carbamate |
| SMILES | COc1ccccc1OCC(O)C(O)NC(=O)[O-] |
| InChI | InChI=1S/C11H15NO6/c1-17-8-4-2-3-5-9(8)18-6-7(13)10(14)12-11(15)16/h2-5,7,10,12-14H,6H2,1H3,(H,15,16)/p-1 |
| InChIKey | RZBRKXAYUNUGIY-UHFFFAOYSA-M |
| XLogP | -1.31 |
| TPSA | 111.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|