2-acetamido-3-(2-methoxyphenoxy)propanoic acid

C12H15NO5 — CID 65443160

IUPAC2-acetamido-3-(2-methoxyphenoxy)propanoic acid
SMILESCOc1ccccc1OCC(NC(C)=O)C(=O)O
InChIInChI=1S/C12H15NO5/c1-8(14)13-9(12(15)16)7-18-11-6-4-3-5-10(11)17-2/h3-6,9H,7H2,1-2H3,(H,13,14)(H,15,16)
InChIKeyPZUIJHUUKVOTIP-UHFFFAOYSA-N
MW253.25 g/mol
LogP0.66
Rot. Bonds6

About 2-acetamido-3-(2-methoxyphenoxy)propanoic acid

2-acetamido-3-(2-methoxyphenoxy)propanoic acid (PubChem CID 65443160) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is 2-acetamido-3-(2-methoxyphenoxy)propanoic acid.

Molecular Properties

Compound Name2-acetamido-3-(2-methoxyphenoxy)propanoic acid
PubChem CID65443160
Molecular FormulaC12H15NO5
Molecular Weight253.25 g/mol
Exact Mass253.10
IUPAC Name2-acetamido-3-(2-methoxyphenoxy)propanoic acid
SMILESCOc1ccccc1OCC(NC(C)=O)C(=O)O
InChIInChI=1S/C12H15NO5/c1-8(14)13-9(12(15)16)7-18-11-6-4-3-5-10(11)17-2/h3-6,9H,7H2,1-2H3,(H,13,14)(H,15,16)
InChIKeyPZUIJHUUKVOTIP-UHFFFAOYSA-N
XLogP0.66
TPSA84.86 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.25
LogP ≤ 50.66
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-acetamido-3-(2-methoxyphenoxy)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

methyl 2-acetamido-3-(2-methoxyphenoxy)propanoate
CID 65442964
2-acetamido-3-(2-bromophenoxy)propanoic acid
CID 65442968
2-acetamido-3-(2-chlorophenoxy)propanoic acid
CID 65443959
2-acetamido-3-(2-iodophenoxy)propanoic acid
CID 65443376
2-acetamido-3-(4-carbamoyl-2-methoxyphenoxy)propanoic acid
CID 65442777
2-acetamido-3-(2-methylsulfanylphenoxy)propanoic acid
CID 65441415
3-(2-methoxyphenoxy)-2-methylpropanoic acid
CID 43537701
2-acetamido-3-[2-(trifluoromethyl)phenoxy]propanoic acid
CID 65442776
2-acetamido-3-(2-prop-2-enylphenoxy)propanoic acid
CID 65442202
2-acetamido-3-[[(1S)-1-(2-methoxyphenyl)ethyl]amino]propanoic acid
CID 81387678
2-acetamido-3-(4-fluorophenoxy)propanoic acid
CID 65442176
2-acetamido-3-(2-methoxybenzoyl)sulfanylpropanoic acid
CID 123843882

Frequently Asked Questions

What is the IUPAC name of 2-acetamido-3-(2-methoxyphenoxy)propanoic acid?
The IUPAC name of 2-acetamido-3-(2-methoxyphenoxy)propanoic acid (CID 65443160) is 2-acetamido-3-(2-methoxyphenoxy)propanoic acid.
What is the SMILES notation for 2-acetamido-3-(2-methoxyphenoxy)propanoic acid?
The canonical SMILES for 2-acetamido-3-(2-methoxyphenoxy)propanoic acid is COc1ccccc1OCC(NC(C)=O)C(=O)O.
What is the InChIKey of 2-acetamido-3-(2-methoxyphenoxy)propanoic acid?
The InChIKey is PZUIJHUUKVOTIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO5/c1-8(14)13-9(12(15)16)7-18-11-6-4-3-5-10(11)17-2/h3-6,9H,7H2,1-2H3,(H,13,14)(H,15,16).
What are the key properties of 2-acetamido-3-(2-methoxyphenoxy)propanoic acid?
2-acetamido-3-(2-methoxyphenoxy)propanoic acid has a molecular weight of 253.25 g/mol, XLogP of 0.66, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamido-3-(2-methoxyphenoxy)propanoic acid is sourced from PubChem (CID 65443160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).