2-acetamido-3-(2-iodophenoxy)propanoic acid

C11H12INO4 — CID 65443376

IUPAC2-acetamido-3-(2-iodophenoxy)propanoic acid
SMILESCC(=O)NC(COc1ccccc1I)C(=O)O
InChIInChI=1S/C11H12INO4/c1-7(14)13-9(11(15)16)6-17-10-5-3-2-4-8(10)12/h2-5,9H,6H2,1H3,(H,13,14)(H,15,16)
InChIKeyFILKLOZCVAHHRQ-UHFFFAOYSA-N
MW349.12 g/mol
LogP1.26
Rot. Bonds5

About 2-acetamido-3-(2-iodophenoxy)propanoic acid

2-acetamido-3-(2-iodophenoxy)propanoic acid (PubChem CID 65443376) has the molecular formula C11H12INO4 and a molecular weight of 349.12 g/mol. Its IUPAC name is 2-acetamido-3-(2-iodophenoxy)propanoic acid.

Molecular Properties

Compound Name2-acetamido-3-(2-iodophenoxy)propanoic acid
PubChem CID65443376
Molecular FormulaC11H12INO4
Molecular Weight349.12 g/mol
Exact Mass348.98
IUPAC Name2-acetamido-3-(2-iodophenoxy)propanoic acid
SMILESCC(=O)NC(COc1ccccc1I)C(=O)O
InChIInChI=1S/C11H12INO4/c1-7(14)13-9(11(15)16)6-17-10-5-3-2-4-8(10)12/h2-5,9H,6H2,1H3,(H,13,14)(H,15,16)
InChIKeyFILKLOZCVAHHRQ-UHFFFAOYSA-N
XLogP1.26
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500349.12
LogP ≤ 51.26
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 2-acetamido-3-(2-iodophenoxy)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-acetamido-3-(2-methoxyphenoxy)propanoic acid
CID 65443160
2-acetamido-3-(2-bromophenoxy)propanoic acid
CID 65442968
2-acetamido-3-(2-chlorophenoxy)propanoic acid
CID 65443959
2-acetamido-3-(2-methylsulfanylphenoxy)propanoic acid
CID 65441415
2-acetamido-3-[2-(trifluoromethyl)phenoxy]propanoic acid
CID 65442776
2-acetamido-3-(2-prop-2-enylphenoxy)propanoic acid
CID 65442202
2-acetamido-3-(2-iodophenyl)propanoic acid
CID 90399104
methyl 2-acetamido-3-(2-methoxyphenoxy)propanoate
CID 65442964
2-acetamido-3-(4-fluorophenoxy)propanoic acid
CID 65442176
2-acetamido-3-(2-chloro-5-fluorophenoxy)propanoic acid
CID 114264196
2-acetamido-3-(2-bromo-4-chlorophenoxy)propanoic acid
CID 65441782
2-acetamido-3-(4-methylsulfanylphenoxy)propanoic acid
CID 65441613

Frequently Asked Questions

What is the IUPAC name of 2-acetamido-3-(2-iodophenoxy)propanoic acid?
The IUPAC name of 2-acetamido-3-(2-iodophenoxy)propanoic acid (CID 65443376) is 2-acetamido-3-(2-iodophenoxy)propanoic acid.
What is the SMILES notation for 2-acetamido-3-(2-iodophenoxy)propanoic acid?
The canonical SMILES for 2-acetamido-3-(2-iodophenoxy)propanoic acid is CC(=O)NC(COc1ccccc1I)C(=O)O.
What is the InChIKey of 2-acetamido-3-(2-iodophenoxy)propanoic acid?
The InChIKey is FILKLOZCVAHHRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12INO4/c1-7(14)13-9(11(15)16)6-17-10-5-3-2-4-8(10)12/h2-5,9H,6H2,1H3,(H,13,14)(H,15,16).
What are the key properties of 2-acetamido-3-(2-iodophenoxy)propanoic acid?
2-acetamido-3-(2-iodophenoxy)propanoic acid has a molecular weight of 349.12 g/mol, XLogP of 1.26, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamido-3-(2-iodophenoxy)propanoic acid is sourced from PubChem (CID 65443376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).