C28H34N2O4 — CID 57106530
3-amino-N-benzhydryl-2-ethyl-4-hydroxy-5-(2-methoxyphenoxy)-2-methylpentanamide (PubChem CID 57106530) has the molecular formula C28H34N2O4 and a molecular weight of 462.59 g/mol. Its IUPAC name is 3-amino-N-benzhydryl-2-ethyl-4-hydroxy-5-(2-methoxyphenoxy)-2-methylpentanamide.
| Compound Name | 3-amino-N-benzhydryl-2-ethyl-4-hydroxy-5-(2-methoxyphenoxy)-2-methylpentanamide |
|---|---|
| PubChem CID | 57106530 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 3-amino-N-benzhydryl-2-ethyl-4-hydroxy-5-(2-methoxyphenoxy)-2-methylpentanamide |
| SMILES | CCC(C)(C(=O)NC(c1ccccc1)c1ccccc1)C(N)C(O)COc1ccccc1OC |
| InChI | InChI=1S/C28H34N2O4/c1-4-28(2,26(29)22(31)19-34-24-18-12-11-17-23(24)33-3)27(32)30-25(20-13-7-5-8-14-20)21-15-9-6-10-16-21/h5-18,22,25-26,31H,4,19,29H2,1-3H3,(H,30,32) |
| InChIKey | VNBDDDHELCWMJK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |