C19H26ClN3O6S — CID 110168539
tert-butyl-[2-hydroxy-3-[4-[(4-nitrophenyl)sulfonylamino]phenoxy]propyl]azanium chloride (PubChem CID 110168539) has the molecular formula C19H26ClN3O6S and a molecular weight of 459.95 g/mol. Its IUPAC name is tert-butyl-[2-hydroxy-3-[4-[(4-nitrophenyl)sulfonylamino]phenoxy]propyl]azanium chloride.
| Compound Name | tert-butyl-[2-hydroxy-3-[4-[(4-nitrophenyl)sulfonylamino]phenoxy]propyl]azanium chloride |
|---|---|
| PubChem CID | 110168539 |
| Molecular Formula | C19H26ClN3O6S |
| Molecular Weight | 459.95 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | tert-butyl-[2-hydroxy-3-[4-[(4-nitrophenyl)sulfonylamino]phenoxy]propyl]azanium chloride |
| SMILES | CC(C)(C)[NH2+]CC(O)COc1ccc(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1.[Cl-] |
| InChI | InChI=1S/C19H25N3O6S.ClH/c1-19(2,3)20-12-16(23)13-28-17-8-4-14(5-9-17)21-29(26,27)18-10-6-15(7-11-18)22(24)25;/h4-11,16,20-21,23H,12-13H2,1-3H3;1H |
| InChIKey | YWZSWEZWADSKKN-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 135.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.95 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|