C20H30NO2+ — CID 9451570
2-adamantyl-[(2S)-2-hydroxy-3-(4-methylphenoxy)propyl]azanium (PubChem CID 9451570) has the molecular formula C20H30NO2+ and a molecular weight of 316.46 g/mol. Its IUPAC name is 2-adamantyl-[(2S)-2-hydroxy-3-(4-methylphenoxy)propyl]azanium.
| Compound Name | 2-adamantyl-[(2S)-2-hydroxy-3-(4-methylphenoxy)propyl]azanium |
|---|---|
| PubChem CID | 9451570 |
| Molecular Formula | C20H30NO2+ |
| Molecular Weight | 316.46 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | 2-adamantyl-[(2S)-2-hydroxy-3-(4-methylphenoxy)propyl]azanium |
| SMILES | Cc1ccc(OC[C@@H](O)C[NH2+]C2C3CC4CC(C3)CC2C4)cc1 |
| InChI | InChI=1S/C20H29NO2/c1-13-2-4-19(5-3-13)23-12-18(22)11-21-20-16-7-14-6-15(9-16)10-17(20)8-14/h2-5,14-18,20-22H,6-12H2,1H3/p+1/t14?,15?,16?,17?,18-,20?/m0/s1 |
| InChIKey | PSGHBNOSEPQIOV-RJFAQORQSA-O |
| XLogP | 2.12 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |