C15H24NO3+ — CID 7473365
cyclopentyl-[(2S)-2-hydroxy-3-(4-methoxyphenoxy)propyl]azanium (PubChem CID 7473365) has the molecular formula C15H24NO3+ and a molecular weight of 266.36 g/mol. Its IUPAC name is cyclopentyl-[(2S)-2-hydroxy-3-(4-methoxyphenoxy)propyl]azanium.
| Compound Name | cyclopentyl-[(2S)-2-hydroxy-3-(4-methoxyphenoxy)propyl]azanium |
|---|---|
| PubChem CID | 7473365 |
| Molecular Formula | C15H24NO3+ |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | cyclopentyl-[(2S)-2-hydroxy-3-(4-methoxyphenoxy)propyl]azanium |
| SMILES | COc1ccc(OC[C@@H](O)C[NH2+]C2CCCC2)cc1 |
| InChI | InChI=1S/C15H23NO3/c1-18-14-6-8-15(9-7-14)19-11-13(17)10-16-12-4-2-3-5-12/h6-9,12-13,16-17H,2-5,10-11H2,1H3/p+1/t13-/m0/s1 |
| InChIKey | AVAOEPBPSCNXFA-ZDUSSCGKSA-O |
| XLogP | 0.94 |
| TPSA | 55.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |