C16H25N2O3+ — CID 7187889
[(2S)-3-(4-acetamidophenoxy)-2-hydroxypropyl]-cyclopentylazanium (PubChem CID 7187889) has the molecular formula C16H25N2O3+ and a molecular weight of 293.39 g/mol. Its IUPAC name is [(2S)-3-(4-acetamidophenoxy)-2-hydroxypropyl]-cyclopentylazanium.
| Compound Name | [(2S)-3-(4-acetamidophenoxy)-2-hydroxypropyl]-cyclopentylazanium |
|---|---|
| PubChem CID | 7187889 |
| Molecular Formula | C16H25N2O3+ |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | [(2S)-3-(4-acetamidophenoxy)-2-hydroxypropyl]-cyclopentylazanium |
| SMILES | CC(=O)Nc1ccc(OC[C@@H](O)C[NH2+]C2CCCC2)cc1 |
| InChI | InChI=1S/C16H24N2O3/c1-12(19)18-14-6-8-16(9-7-14)21-11-15(20)10-17-13-4-2-3-5-13/h6-9,13,15,17,20H,2-5,10-11H2,1H3,(H,18,19)/p+1/t15-/m0/s1 |
| InChIKey | JBQPSRMRWULQNY-HNNXBMFYSA-O |
| XLogP | 0.89 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |