About O-(3,3,5-trimethyl-6-phenoxyhexan-2-yl)hydroxylamine
O-(3,3,5-trimethyl-6-phenoxyhexan-2-yl)hydroxylamine (PubChem CID 59956887) has the molecular formula C15H25NO2
and a molecular weight of 251.37 g/mol. Its IUPAC name is O-(3,3,5-trimethyl-6-phenoxyhexan-2-yl)hydroxylamine.
Molecular Properties
| Compound Name | O-(3,3,5-trimethyl-6-phenoxyhexan-2-yl)hydroxylamine |
| PubChem CID | 59956887 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | O-(3,3,5-trimethyl-6-phenoxyhexan-2-yl)hydroxylamine |
| SMILES | CC(COc1ccccc1)CC(C)(C)C(C)ON |
| InChI | InChI=1S/C15H25NO2/c1-12(10-15(3,4)13(2)18-16)11-17-14-8-6-5-7-9-14/h5-9,12-13H,10-11,16H2,1-4H3 |
| InChIKey | SDYJWXCXTZEGPN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-(3,3,5-trimethyl-6-phenoxyhexan-2-yl)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(3,3,5-trimethyl-6-phenoxyhexan-2-yl)hydroxylamine?
The IUPAC name of O-(3,3,5-trimethyl-6-phenoxyhexan-2-yl)hydroxylamine (CID 59956887) is O-(3,3,5-trimethyl-6-phenoxyhexan-2-yl)hydroxylamine.
What is the SMILES notation for O-(3,3,5-trimethyl-6-phenoxyhexan-2-yl)hydroxylamine?
The canonical SMILES for O-(3,3,5-trimethyl-6-phenoxyhexan-2-yl)hydroxylamine is CC(COc1ccccc1)CC(C)(C)C(C)ON.
What is the InChIKey of O-(3,3,5-trimethyl-6-phenoxyhexan-2-yl)hydroxylamine?
The InChIKey is SDYJWXCXTZEGPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO2/c1-12(10-15(3,4)13(2)18-16)11-17-14-8-6-5-7-9-14/h5-9,12-13H,10-11,16H2,1-4H3.
What are the key properties of O-(3,3,5-trimethyl-6-phenoxyhexan-2-yl)hydroxylamine?
O-(3,3,5-trimethyl-6-phenoxyhexan-2-yl)hydroxylamine has a molecular weight of 251.37 g/mol, XLogP of 3.40, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-(3,3,5-trimethyl-6-phenoxyhexan-2-yl)hydroxylamine is sourced from PubChem (CID 59956887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).