C13H18O4 — CID 117242558
2-[(4-hydroxyphenoxy)methyl]-3,3-dimethylbutanoic acid (PubChem CID 117242558) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is 2-[(4-hydroxyphenoxy)methyl]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[(4-hydroxyphenoxy)methyl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 117242558 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2-[(4-hydroxyphenoxy)methyl]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(COc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C13H18O4/c1-13(2,3)11(12(15)16)8-17-10-6-4-9(14)5-7-10/h4-7,11,14H,8H2,1-3H3,(H,15,16) |
| InChIKey | IBJSGQWVPGQMRV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |