C9H10F2O — CID 141126062
2,3-difluoropropoxybenzene (PubChem CID 141126062) has the molecular formula C9H10F2O and a molecular weight of 172.17 g/mol. Its IUPAC name is 2,3-difluoropropoxybenzene.
| Compound Name | 2,3-difluoropropoxybenzene |
|---|---|
| PubChem CID | 141126062 |
| Molecular Formula | C9H10F2O |
| Molecular Weight | 172.17 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 2,3-difluoropropoxybenzene |
| SMILES | FCC(F)COc1ccccc1 |
| InChI | InChI=1S/C9H10F2O/c10-6-8(11)7-12-9-4-2-1-3-5-9/h1-5,8H,6-7H2 |
| InChIKey | DJMMKNPCUFHREE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.17 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |