C12H16F2O — CID 97103069
[(2S,3R)-2,3-difluorohexoxy]benzene (PubChem CID 97103069) has the molecular formula C12H16F2O and a molecular weight of 214.26 g/mol. Its IUPAC name is [(2S,3R)-2,3-difluorohexoxy]benzene.
| Compound Name | [(2S,3R)-2,3-difluorohexoxy]benzene |
|---|---|
| PubChem CID | 97103069 |
| Molecular Formula | C12H16F2O |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | [(2S,3R)-2,3-difluorohexoxy]benzene |
| SMILES | CCC[C@@H](F)[C@@H](F)COc1ccccc1 |
| InChI | InChI=1S/C12H16F2O/c1-2-6-11(13)12(14)9-15-10-7-4-3-5-8-10/h3-5,7-8,11-12H,2,6,9H2,1H3/t11-,12+/m1/s1 |
| InChIKey | GQKYDDAXMLJMNB-NEPJUHHUSA-N |
| XLogP | 3.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |