C12H17ClO3S — CID 65012905
2-(phenoxymethyl)pentane-1-sulfonyl chloride (PubChem CID 65012905) has the molecular formula C12H17ClO3S and a molecular weight of 276.78 g/mol. Its IUPAC name is 2-(phenoxymethyl)pentane-1-sulfonyl chloride.
| Compound Name | 2-(phenoxymethyl)pentane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 65012905 |
| Molecular Formula | C12H17ClO3S |
| Molecular Weight | 276.78 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 2-(phenoxymethyl)pentane-1-sulfonyl chloride |
| SMILES | CCCC(COc1ccccc1)CS(=O)(=O)Cl |
| InChI | InChI=1S/C12H17ClO3S/c1-2-6-11(10-17(13,14)15)9-16-12-7-4-3-5-8-12/h3-5,7-8,11H,2,6,9-10H2,1H3 |
| InChIKey | QOYYZQIUFZKAOZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.78 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |