C12H15Cl2FO3S — CID 116690829
2-[(3-chloro-2-fluorophenoxy)methyl]pentane-1-sulfonyl chloride (PubChem CID 116690829) has the molecular formula C12H15Cl2FO3S and a molecular weight of 329.22 g/mol. Its IUPAC name is 2-[(3-chloro-2-fluorophenoxy)methyl]pentane-1-sulfonyl chloride.
| Compound Name | 2-[(3-chloro-2-fluorophenoxy)methyl]pentane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 116690829 |
| Molecular Formula | C12H15Cl2FO3S |
| Molecular Weight | 329.22 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 2-[(3-chloro-2-fluorophenoxy)methyl]pentane-1-sulfonyl chloride |
| SMILES | CCCC(COc1cccc(Cl)c1F)CS(=O)(=O)Cl |
| InChI | InChI=1S/C12H15Cl2FO3S/c1-2-4-9(8-19(14,16)17)7-18-11-6-3-5-10(13)12(11)15/h3,5-6,9H,2,4,7-8H2,1H3 |
| InChIKey | NEXAGURKRLDKPX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.22 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |