C11H15F2NO3S — CID 64998716
2-[(2,3-difluorophenoxy)methyl]butane-1-sulfonamide (PubChem CID 64998716) has the molecular formula C11H15F2NO3S and a molecular weight of 279.31 g/mol. Its IUPAC name is 2-[(2,3-difluorophenoxy)methyl]butane-1-sulfonamide.
| Compound Name | 2-[(2,3-difluorophenoxy)methyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 64998716 |
| Molecular Formula | C11H15F2NO3S |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2-[(2,3-difluorophenoxy)methyl]butane-1-sulfonamide |
| SMILES | CCC(COc1cccc(F)c1F)CS(N)(=O)=O |
| InChI | InChI=1S/C11H15F2NO3S/c1-2-8(7-18(14,15)16)6-17-10-5-3-4-9(12)11(10)13/h3-5,8H,2,6-7H2,1H3,(H2,14,15,16) |
| InChIKey | JOLZLBSSGBLIFM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |