C13H18ClFO3S — CID 107661808
2-[(2-fluoro-3-methylphenoxy)methyl]pentane-1-sulfonyl chloride (PubChem CID 107661808) has the molecular formula C13H18ClFO3S and a molecular weight of 308.80 g/mol. Its IUPAC name is 2-[(2-fluoro-3-methylphenoxy)methyl]pentane-1-sulfonyl chloride.
| Compound Name | 2-[(2-fluoro-3-methylphenoxy)methyl]pentane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 107661808 |
| Molecular Formula | C13H18ClFO3S |
| Molecular Weight | 308.80 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 2-[(2-fluoro-3-methylphenoxy)methyl]pentane-1-sulfonyl chloride |
| SMILES | CCCC(COc1cccc(C)c1F)CS(=O)(=O)Cl |
| InChI | InChI=1S/C13H18ClFO3S/c1-3-5-11(9-19(14,16)17)8-18-12-7-4-6-10(2)13(12)15/h4,6-7,11H,3,5,8-9H2,1-2H3 |
| InChIKey | OBPTZSVXFSLTGP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.80 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |