C14H21ClO4S — CID 65012961
2-[(3-ethoxyphenoxy)methyl]pentane-1-sulfonyl chloride (PubChem CID 65012961) has the molecular formula C14H21ClO4S and a molecular weight of 320.84 g/mol. Its IUPAC name is 2-[(3-ethoxyphenoxy)methyl]pentane-1-sulfonyl chloride.
| Compound Name | 2-[(3-ethoxyphenoxy)methyl]pentane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 65012961 |
| Molecular Formula | C14H21ClO4S |
| Molecular Weight | 320.84 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2-[(3-ethoxyphenoxy)methyl]pentane-1-sulfonyl chloride |
| SMILES | CCCC(COc1cccc(OCC)c1)CS(=O)(=O)Cl |
| InChI | InChI=1S/C14H21ClO4S/c1-3-6-12(11-20(15,16)17)10-19-14-8-5-7-13(9-14)18-4-2/h5,7-9,12H,3-4,6,10-11H2,1-2H3 |
| InChIKey | XKUUOCUQXOWKQJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.84 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |