C14H21ClO4S — CID 65013237
2-[(3-ethoxyphenoxy)methyl]-3-methylbutane-1-sulfonyl chloride (PubChem CID 65013237) has the molecular formula C14H21ClO4S and a molecular weight of 320.84 g/mol. Its IUPAC name is 2-[(3-ethoxyphenoxy)methyl]-3-methylbutane-1-sulfonyl chloride.
| Compound Name | 2-[(3-ethoxyphenoxy)methyl]-3-methylbutane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 65013237 |
| Molecular Formula | C14H21ClO4S |
| Molecular Weight | 320.84 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2-[(3-ethoxyphenoxy)methyl]-3-methylbutane-1-sulfonyl chloride |
| SMILES | CCOc1cccc(OCC(CS(=O)(=O)Cl)C(C)C)c1 |
| InChI | InChI=1S/C14H21ClO4S/c1-4-18-13-6-5-7-14(8-13)19-9-12(11(2)3)10-20(15,16)17/h5-8,11-12H,4,9-10H2,1-3H3 |
| InChIKey | ZWQIUVUKOGAJSX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.84 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |