C12H15BrClFO3S — CID 65012781
2-[(4-bromo-2-fluorophenoxy)methyl]-3-methylbutane-1-sulfonyl chloride (PubChem CID 65012781) has the molecular formula C12H15BrClFO3S and a molecular weight of 373.67 g/mol. Its IUPAC name is 2-[(4-bromo-2-fluorophenoxy)methyl]-3-methylbutane-1-sulfonyl chloride.
| Compound Name | 2-[(4-bromo-2-fluorophenoxy)methyl]-3-methylbutane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 65012781 |
| Molecular Formula | C12H15BrClFO3S |
| Molecular Weight | 373.67 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | 2-[(4-bromo-2-fluorophenoxy)methyl]-3-methylbutane-1-sulfonyl chloride |
| SMILES | CC(C)C(COc1ccc(Br)cc1F)CS(=O)(=O)Cl |
| InChI | InChI=1S/C12H15BrClFO3S/c1-8(2)9(7-19(14,16)17)6-18-12-4-3-10(13)5-11(12)15/h3-5,8-9H,6-7H2,1-2H3 |
| InChIKey | OOLDZFCHEYTOPX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.67 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |