C13H16BrClF2O3S — CID 107102074
2-[(5-bromo-2,3-difluorophenoxy)methyl]-3,3-dimethylbutane-1-sulfonyl chloride (PubChem CID 107102074) has the molecular formula C13H16BrClF2O3S and a molecular weight of 405.69 g/mol. Its IUPAC name is 2-[(5-bromo-2,3-difluorophenoxy)methyl]-3,3-dimethylbutane-1-sulfonyl chloride.
| Compound Name | 2-[(5-bromo-2,3-difluorophenoxy)methyl]-3,3-dimethylbutane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 107102074 |
| Molecular Formula | C13H16BrClF2O3S |
| Molecular Weight | 405.69 g/mol |
| Exact Mass | 403.97 |
| IUPAC Name | 2-[(5-bromo-2,3-difluorophenoxy)methyl]-3,3-dimethylbutane-1-sulfonyl chloride |
| SMILES | CC(C)(C)C(COc1cc(Br)cc(F)c1F)CS(=O)(=O)Cl |
| InChI | InChI=1S/C13H16BrClF2O3S/c1-13(2,3)8(7-21(15,18)19)6-20-11-5-9(14)4-10(16)12(11)17/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | JRHVMSPAUJBMIE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.69 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|