C12H16Cl3NO3S — CID 65013064
2-[(2,4,5-trichlorophenoxy)methyl]pentane-1-sulfonamide (PubChem CID 65013064) has the molecular formula C12H16Cl3NO3S and a molecular weight of 360.69 g/mol. Its IUPAC name is 2-[(2,4,5-trichlorophenoxy)methyl]pentane-1-sulfonamide.
| Compound Name | 2-[(2,4,5-trichlorophenoxy)methyl]pentane-1-sulfonamide |
|---|---|
| PubChem CID | 65013064 |
| Molecular Formula | C12H16Cl3NO3S |
| Molecular Weight | 360.69 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | 2-[(2,4,5-trichlorophenoxy)methyl]pentane-1-sulfonamide |
| SMILES | CCCC(COc1cc(Cl)c(Cl)cc1Cl)CS(N)(=O)=O |
| InChI | InChI=1S/C12H16Cl3NO3S/c1-2-3-8(7-20(16,17)18)6-19-12-5-10(14)9(13)4-11(12)15/h4-5,8H,2-3,6-7H2,1H3,(H2,16,17,18) |
| InChIKey | SUGOKQHOLLILMP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.69 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|