C13H20BrNO3S — CID 65012663
2-[(2-bromo-4-methylphenoxy)methyl]pentane-1-sulfonamide (PubChem CID 65012663) has the molecular formula C13H20BrNO3S and a molecular weight of 350.28 g/mol. Its IUPAC name is 2-[(2-bromo-4-methylphenoxy)methyl]pentane-1-sulfonamide.
| Compound Name | 2-[(2-bromo-4-methylphenoxy)methyl]pentane-1-sulfonamide |
|---|---|
| PubChem CID | 65012663 |
| Molecular Formula | C13H20BrNO3S |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 2-[(2-bromo-4-methylphenoxy)methyl]pentane-1-sulfonamide |
| SMILES | CCCC(COc1ccc(C)cc1Br)CS(N)(=O)=O |
| InChI | InChI=1S/C13H20BrNO3S/c1-3-4-11(9-19(15,16)17)8-18-13-6-5-10(2)7-12(13)14/h5-7,11H,3-4,8-9H2,1-2H3,(H2,15,16,17) |
| InChIKey | GPRTXNMSVGSFPU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |