C14H23NO4S — CID 65012969
2-[(2-methoxy-4-methylphenoxy)methyl]pentane-1-sulfonamide (PubChem CID 65012969) has the molecular formula C14H23NO4S and a molecular weight of 301.41 g/mol. Its IUPAC name is 2-[(2-methoxy-4-methylphenoxy)methyl]pentane-1-sulfonamide.
| Compound Name | 2-[(2-methoxy-4-methylphenoxy)methyl]pentane-1-sulfonamide |
|---|---|
| PubChem CID | 65012969 |
| Molecular Formula | C14H23NO4S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-[(2-methoxy-4-methylphenoxy)methyl]pentane-1-sulfonamide |
| SMILES | CCCC(COc1ccc(C)cc1OC)CS(N)(=O)=O |
| InChI | InChI=1S/C14H23NO4S/c1-4-5-12(10-20(15,16)17)9-19-13-7-6-11(2)8-14(13)18-3/h6-8,12H,4-5,9-10H2,1-3H3,(H2,15,16,17) |
| InChIKey | KDOGSASYUPXELF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |