C14H23NO — CID 107893778
N,3-dimethyl-1-phenoxyhexan-2-amine (PubChem CID 107893778) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is N,3-dimethyl-1-phenoxyhexan-2-amine.
| Compound Name | N,3-dimethyl-1-phenoxyhexan-2-amine |
|---|---|
| PubChem CID | 107893778 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | N,3-dimethyl-1-phenoxyhexan-2-amine |
| SMILES | CCCC(C)C(COc1ccccc1)NC |
| InChI | InChI=1S/C14H23NO/c1-4-8-12(2)14(15-3)11-16-13-9-6-5-7-10-13/h5-7,9-10,12,14-15H,4,8,11H2,1-3H3 |
| InChIKey | HEBBBSGIVNAXAK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |